C37H44O17 — CID 162258792
benzyl 3-[(2S)-3,6-dioxo-1,4-dioxan-2-yl]propanoate;5-O-benzyl 1-O-pentyl 2-[2-[2-(2-hydroxyacetyl)oxyacetyl]oxyacetyl]oxypentanedioate (PubChem CID 162258792) has the molecular formula C37H44O17 and a molecular weight of 760.74 g/mol. Its IUPAC name is benzyl 3-[(2S)-3,6-dioxo-1,4-dioxan-2-yl]propanoate;5-O-benzyl 1-O-pentyl 2-[2-[2-(2-hydroxyacetyl)oxyacetyl]oxyacetyl]oxypentanedioate.
| Compound Name | benzyl 3-[(2S)-3,6-dioxo-1,4-dioxan-2-yl]propanoate;5-O-benzyl 1-O-pentyl 2-[2-[2-(2-hydroxyacetyl)oxyacetyl]oxyacetyl]oxypentanedioate |
|---|---|
| PubChem CID | 162258792 |
| Molecular Formula | C37H44O17 |
| Molecular Weight | 760.74 g/mol |
| Exact Mass | 760.26 |
| IUPAC Name | benzyl 3-[(2S)-3,6-dioxo-1,4-dioxan-2-yl]propanoate;5-O-benzyl 1-O-pentyl 2-[2-[2-(2-hydroxyacetyl)oxyacetyl]oxyacetyl]oxypentanedioate |
| SMILES | CCCCCOC(=O)C(CCC(=O)OCc1ccccc1)OC(=O)COC(=O)COC(=O)CO.O=C(CC[C@@H]1OC(=O)COC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H30O11.C14H14O6/c1-2-3-7-12-30-23(29)18(10-11-19(25)31-14-17-8-5-4-6-9-17)34-22(28)16-33-21(27)15-32-20(26)13-24;15-12(18-8-10-4-2-1-3-5-10)7-6-11-14(17)19-9-13(16)20-11/h4-6,8-9,18,24H,2-3,7,10-16H2,1H3;1-5,11H,6-9H2/t;11-/m.0/s1 |
| InChIKey | ZYYIQHDNMSIFDS-WUSPCOQVSA-N |
| XLogP | 2.21 |
| TPSA | 230.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|