C23H33F2INO- — CID 162261648
2-[3-(2,6-difluorophenyl)propoxy]-N,N-dimethyl-2-(2,4,6-trimethylphenyl)ethanamine;methane;iodide (PubChem CID 162261648) has the molecular formula C23H33F2INO- and a molecular weight of 504.42 g/mol. Its IUPAC name is 2-[3-(2,6-difluorophenyl)propoxy]-N,N-dimethyl-2-(2,4,6-trimethylphenyl)ethanamine;methane;iodide.
| Compound Name | 2-[3-(2,6-difluorophenyl)propoxy]-N,N-dimethyl-2-(2,4,6-trimethylphenyl)ethanamine;methane;iodide |
|---|---|
| PubChem CID | 162261648 |
| Molecular Formula | C23H33F2INO- |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[3-(2,6-difluorophenyl)propoxy]-N,N-dimethyl-2-(2,4,6-trimethylphenyl)ethanamine;methane;iodide |
| SMILES | C.Cc1cc(C)c(C(CN(C)C)OCCCc2c(F)cccc2F)c(C)c1.[I-] |
| InChI | InChI=1S/C22H29F2NO.CH4.HI/c1-15-12-16(2)22(17(3)13-15)21(14-25(4)5)26-11-7-8-18-19(23)9-6-10-20(18)24;;/h6,9-10,12-13,21H,7-8,11,14H2,1-5H3;1H4;1H/p-1 |
| InChIKey | QRXBOQBPYVBKTP-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|