C14H16N2O — CID 162262506
5-(2-cyclopropylethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 162262506) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 5-(2-cyclopropylethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-cyclopropylethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162262506 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-(2-cyclopropylethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc(CCC3CC3)n2)cc1 |
| InChI | InChI=1S/C14H16N2O/c1-10-2-7-12(8-3-10)14-15-13(17-16-14)9-6-11-4-5-11/h2-3,7-8,11H,4-6,9H2,1H3 |
| InChIKey | ZZLCJRKUROEINP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |