About 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid
1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid (PubChem CID 162262845) has the molecular formula C28H45O3P
and a molecular weight of 460.64 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid.
Molecular Properties
| Compound Name | 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid |
| PubChem CID | 162262845 |
| Molecular Formula | C28H45O3P |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.OP(O)O |
| InChI | InChI=1S/C28H42.H3O3P/c1-25(2,3)21-13-19(14-22(17-21)26(4,5)6)20-15-23(27(7,8)9)18-24(16-20)28(10,11)12;1-4(2)3/h13-18H,1-12H3;1-3H |
| InChIKey | ZZMIKJXQBHFFEW-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid?
The IUPAC name of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid (CID 162262845) is 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid.
What is the SMILES notation for 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid?
The canonical SMILES for 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid is CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.OP(O)O.
What is the InChIKey of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid?
The InChIKey is ZZMIKJXQBHFFEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42.H3O3P/c1-25(2,3)21-13-19(14-22(17-21)26(4,5)6)20-15-23(27(7,8)9)18-24(16-20)28(10,11)12;1-4(2)3/h13-18H,1-12H3;1-3H.
What are the key properties of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid?
1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid has a molecular weight of 460.64 g/mol, XLogP of 7.73, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)benzene;phosphorous acid is sourced from PubChem (CID 162262845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).