About 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+)
1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) (PubChem CID 162263063) has the molecular formula C13H16ORu
and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+).
Molecular Properties
| Compound Name | 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) |
| PubChem CID | 162263063 |
| Molecular Formula | C13H16ORu |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) |
| SMILES | CCc1ccc[cH-]1.COc1ccc[cH-]1.[Ru+2] |
| InChI | InChI=1S/C7H9.C6H7O.Ru/c1-2-7-5-3-4-6-7;1-7-6-4-2-3-5-6;/h3-6H,2H2,1H3;2-5H,1H3;/q2*-1;+2 |
| InChIKey | ZZNBRPSECNSUSN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+)?
The IUPAC name of 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) (CID 162263063) is 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+).
What is the SMILES notation for 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+)?
The canonical SMILES for 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) is CCc1ccc[cH-]1.COc1ccc[cH-]1.[Ru+2].
What is the InChIKey of 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+)?
The InChIKey is ZZNBRPSECNSUSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.C6H7O.Ru/c1-2-7-5-3-4-6-7;1-7-6-4-2-3-5-6;/h3-6H,2H2,1H3;2-5H,1H3;/q2*-1;+2.
What are the key properties of 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+)?
1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) has a molecular weight of 289.34 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylcyclopenta-1,3-diene;1-methoxycyclopenta-1,3-diene;ruthenium(2+) is sourced from PubChem (CID 162263063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).