About 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione
2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione (PubChem CID 162264897) has the molecular formula C15H12BrCl2FN2O2S
and a molecular weight of 454.15 g/mol. Its IUPAC name is 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione |
| PubChem CID | 162264897 |
| Molecular Formula | C15H12BrCl2FN2O2S |
| Molecular Weight | 454.15 g/mol |
| Exact Mass | 451.92 |
| IUPAC Name | 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione |
| SMILES | CCc1cc(Cl)cc(N)c1O.Fc1c(Cl)cc2[nH]c(=S)oc2c1Br |
| InChI | InChI=1S/C8H10ClNO.C7H2BrClFNOS/c1-2-5-3-6(9)4-7(10)8(5)11;8-4-5(10)2(9)1-3-6(4)12-7(13)11-3/h3-4,11H,2,10H2,1H3;1H,(H,11,13) |
| InChIKey | ZZTPRBOTNBONRH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.15 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione?
The IUPAC name of 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione (CID 162264897) is 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione.
What is the SMILES notation for 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione?
The canonical SMILES for 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione is CCc1cc(Cl)cc(N)c1O.Fc1c(Cl)cc2[nH]c(=S)oc2c1Br.
What is the InChIKey of 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione?
The InChIKey is ZZTPRBOTNBONRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO.C7H2BrClFNOS/c1-2-5-3-6(9)4-7(10)8(5)11;8-4-5(10)2(9)1-3-6(4)12-7(13)11-3/h3-4,11H,2,10H2,1H3;1H,(H,11,13).
What are the key properties of 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione?
2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione has a molecular weight of 454.15 g/mol, XLogP of 6.24, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-chloro-6-ethylphenol;7-bromo-5-chloro-6-fluoro-3H-1,3-benzoxazole-2-thione is sourced from PubChem (CID 162264897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).