C21H19F2N3O5 — CID 162265180
methyl 2-(3-fluoro-5-methoxyanilino)pyridine-3-carboxylate;methyl 2-fluoropyridine-3-carboxylate (PubChem CID 162265180) has the molecular formula C21H19F2N3O5 and a molecular weight of 431.40 g/mol. Its IUPAC name is methyl 2-(3-fluoro-5-methoxyanilino)pyridine-3-carboxylate;methyl 2-fluoropyridine-3-carboxylate.
| Compound Name | methyl 2-(3-fluoro-5-methoxyanilino)pyridine-3-carboxylate;methyl 2-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 162265180 |
| Molecular Formula | C21H19F2N3O5 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | methyl 2-(3-fluoro-5-methoxyanilino)pyridine-3-carboxylate;methyl 2-fluoropyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1F.COC(=O)c1cccnc1Nc1cc(F)cc(OC)c1 |
| InChI | InChI=1S/C14H13FN2O3.C7H6FNO2/c1-19-11-7-9(15)6-10(8-11)17-13-12(14(18)20-2)4-3-5-16-13;1-11-7(10)5-3-2-4-9-6(5)8/h3-8H,1-2H3,(H,16,17);2-4H,1H3 |
| InChIKey | ZZUQNQASCXYRRX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|