C35H34BF7O6 — CID 162265756
2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid;4,4,5,5-tetramethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,2-dioxaborolane (PubChem CID 162265756) has the molecular formula C35H34BF7O6 and a molecular weight of 694.45 g/mol. Its IUPAC name is 2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid;4,4,5,5-tetramethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,2-dioxaborolane.
| Compound Name | 2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid;4,4,5,5-tetramethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162265756 |
| Molecular Formula | C35H34BF7O6 |
| Molecular Weight | 694.45 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | 2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid;4,4,5,5-tetramethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(Cc2ccc(OC(F)(F)F)cc2)OC1(C)C.Cc1c(CC(=O)O)cc2ccc(F)cc2c1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F4O3.C14H18BF3O3/c1-12-15(10-20(26)27)9-14-4-5-16(22)11-19(14)18(12)8-13-2-6-17(7-3-13)28-21(23,24)25;1-12(2)13(3,4)21-15(20-12)9-10-5-7-11(8-6-10)19-14(16,17)18/h2-7,9,11H,8,10H2,1H3,(H,26,27);5-8H,9H2,1-4H3 |
| InChIKey | ZZWMUEUITCEESS-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.45 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|