About 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium
2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium (PubChem CID 162266095) has the molecular formula C30H30O4S
and a molecular weight of 486.63 g/mol. Its IUPAC name is 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium |
| PubChem CID | 162266095 |
| Molecular Formula | C30H30O4S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium |
| SMILES | O=C([O-])C(=O)OC12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H16O4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-10(14)11(15)16-12-4-7-1-8(5-12)3-9(2-7)6-12/h1-15H;7-9H,1-6H2,(H,13,14)/q+1;/p-1 |
| InChIKey | ZZXPBBGDNLNWFR-UHFFFAOYSA-M |
| XLogP | 5.03 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium?
The IUPAC name of 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium (CID 162266095) is 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium.
What is the SMILES notation for 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium?
The canonical SMILES for 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium is O=C([O-])C(=O)OC12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium?
The InChIKey is ZZXPBBGDNLNWFR-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C12H16O4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-10(14)11(15)16-12-4-7-1-8(5-12)3-9(2-7)6-12/h1-15H;7-9H,1-6H2,(H,13,14)/q+1;/p-1.
What are the key properties of 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium?
2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium has a molecular weight of 486.63 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyloxy)-2-oxoacetate;triphenylsulfanium is sourced from PubChem (CID 162266095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).