C24H36BNO5S — CID 162266932
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]acetate (PubChem CID 162266932) has the molecular formula C24H36BNO5S and a molecular weight of 461.43 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]acetate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 162266932 |
| Molecular Formula | C24H36BNO5S |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 2-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]acetate |
| SMILES | CC1(C)OB(c2ccc(COC(=O)CC3CCC(CNC(=O)CCS)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H36BNO5S/c1-23(2)24(3,4)31-25(30-23)20-9-7-17(8-10-20)16-29-22(28)14-18-5-6-19(13-18)15-26-21(27)11-12-32/h7-10,18-19,32H,5-6,11-16H2,1-4H3,(H,26,27) |
| InChIKey | DAYVSPGJWSNVLB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|