C28H42Si2 — CID 162267524
cyclopentyl-[dimethyl-(4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silyl]-dimethylsilane (PubChem CID 162267524) has the molecular formula C28H42Si2 and a molecular weight of 434.82 g/mol. Its IUPAC name is cyclopentyl-[dimethyl-(4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silyl]-dimethylsilane.
| Compound Name | cyclopentyl-[dimethyl-(4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silyl]-dimethylsilane |
|---|---|
| PubChem CID | 162267524 |
| Molecular Formula | C28H42Si2 |
| Molecular Weight | 434.82 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | cyclopentyl-[dimethyl-(4-naphthalen-1-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)silyl]-dimethylsilane |
| SMILES | C[Si](C)(C1CCCC1)[Si](C)(C)C1CCC2C(c3cccc4ccccc34)CCCC21 |
| InChI | InChI=1S/C28H42Si2/c1-29(2,22-13-6-7-14-22)30(3,4)28-20-19-26-25(17-10-18-27(26)28)24-16-9-12-21-11-5-8-15-23(21)24/h5,8-9,11-12,15-16,22,25-28H,6-7,10,13-14,17-20H2,1-4H3 |
| InChIKey | NCNDLBSBXXKAIW-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.82 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|