C70H39NSi — CID 162267954
N-[[9,9-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-3-yl]-dimethylsilyl]-N-tert-butyl-2-methylpropan-2-amine (PubChem CID 162267954) has the molecular formula C70H39NSi and a molecular weight of 922.17 g/mol. Its IUPAC name is N-[[9,9-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-3-yl]-dimethylsilyl]-N-tert-butyl-2-methylpropan-2-amine.
| Compound Name | N-[[9,9-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-3-yl]-dimethylsilyl]-N-tert-butyl-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 162267954 |
| Molecular Formula | C70H39NSi |
| Molecular Weight | 922.17 g/mol |
| Exact Mass | 921.29 |
| IUPAC Name | N-[[9,9-bis(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-3-yl]-dimethylsilyl]-N-tert-butyl-2-methylpropan-2-amine |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC1(C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C)C2=CC3CCC([Si](C)(C)N(C(C)(C)C)C(C)(C)C)C3C=C2c2ccccc21 |
| InChI | InChI=1S/C70H39NSi/c1-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-45-47-51-57-70(58-52-48-46-44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-2)65-54-50-49-53-62(65)64-60-63-61(59-66(64)70)55-56-67(63)72(9,10)71(68(3,4)5)69(6,7)8/h1-2,49-50,53-54,59-61,63,67H,55-56H2,3-10H3 |
| InChIKey | PXEWTEKTOAJKNN-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.17 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|