C28H27N3O+2 — CID 162268235
(14S,18S)-18-benzyl-5-phenyl-12-aza-4,18-diazoniapentacyclo[10.6.0.01,4.06,11.014,18]octadeca-4,6,8,10-tetraen-13-one (PubChem CID 162268235) has the molecular formula C28H27N3O+2 and a molecular weight of 421.54 g/mol. Its IUPAC name is (14S,18S)-18-benzyl-5-phenyl-12-aza-4,18-diazoniapentacyclo[10.6.0.01,4.06,11.014,18]octadeca-4,6,8,10-tetraen-13-one.
| Compound Name | (14S,18S)-18-benzyl-5-phenyl-12-aza-4,18-diazoniapentacyclo[10.6.0.01,4.06,11.014,18]octadeca-4,6,8,10-tetraen-13-one |
|---|---|
| PubChem CID | 162268235 |
| Molecular Formula | C28H27N3O+2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (14S,18S)-18-benzyl-5-phenyl-12-aza-4,18-diazoniapentacyclo[10.6.0.01,4.06,11.014,18]octadeca-4,6,8,10-tetraen-13-one |
| SMILES | O=C1[C@@H]2CCC[N@@+]2(Cc2ccccc2)C23CC[N+]2=C(c2ccccc2)c2ccccc2N13 |
| InChI | InChI=1S/C28H27N3O/c32-27-25-16-9-19-31(25,20-21-10-3-1-4-11-21)28-17-18-29(28)26(22-12-5-2-6-13-22)23-14-7-8-15-24(23)30(27)28/h1-8,10-15,25H,9,16-20H2/q+2/t25-,28?,31-/m0/s1 |
| InChIKey | GEMAIZYZTSZXKQ-POVRNTTPSA-N |
| XLogP | 4.13 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|