C17H24 — CID 162268770
1,2,3,4,5-pentamethyl-6-(4-methylpenta-1,3-dien-2-yl)benzene (PubChem CID 162268770) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-(4-methylpenta-1,3-dien-2-yl)benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-(4-methylpenta-1,3-dien-2-yl)benzene |
|---|---|
| PubChem CID | 162268770 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-(4-methylpenta-1,3-dien-2-yl)benzene |
| SMILES | C=C(C=C(C)C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C17H24/c1-10(2)9-11(3)17-15(7)13(5)12(4)14(6)16(17)8/h9H,3H2,1-2,4-8H3 |
| InChIKey | KHSYYWMGCUBLFC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|