C28H42 — CID 162269004
1-[2-(5,6-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 162269004) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is 1-[2-(5,6-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-[2-(5,6-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 162269004 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | 1-[2-(5,6-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC1=CC2CCC(CCC3C(C)C(C)C4C(C)=C(C)C(C)=C(C)C34)C2C=C1C |
| InChI | InChI=1S/C28H42/c1-15-13-24-10-9-23(26(24)14-16(15)2)11-12-25-19(5)22(8)27-20(6)17(3)18(4)21(7)28(25)27/h13-14,19,22-28H,9-12H2,1-8H3 |
| InChIKey | VEANSWDBVKOBIF-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |