C34H36O6 — CID 162269561
4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaenyl]-1,3-dioxolan-2-one (PubChem CID 162269561) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is 4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaenyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 162269561 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaenyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CC=CC=CC=CC=CC=CC=CC=CC=CC=CC=CC=CC=CC=CCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C34H36O6/c35-33-37-29-31(39-33)27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28-32-30-38-34(36)40-32/h1-26,31-32H,27-30H2 |
| InChIKey | WTDGIYHFIKITKK-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|