C36H46O6 — CID 162270540
methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,12,14,16,18,20,22,24,26-dodecaenyl]-1,3-dioxolan-2-one (PubChem CID 162270540) has the molecular formula C36H46O6 and a molecular weight of 574.76 g/mol. Its IUPAC name is methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,12,14,16,18,20,22,24,26-dodecaenyl]-1,3-dioxolan-2-one.
| Compound Name | methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,12,14,16,18,20,22,24,26-dodecaenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 162270540 |
| Molecular Formula | C36H46O6 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,4,6,8,12,14,16,18,20,22,24,26-dodecaenyl]-1,3-dioxolan-2-one |
| SMILES | C.C.O=C1OCC(CC=CC=CC=CC=CC=CC=CC=CC=CCCC=CC=CC=CC=CCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C34H38O6.2CH4/c35-33-37-29-31(39-33)27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28-32-30-38-34(36)40-32;;/h1-7,9,11-26,31-32H,8,10,27-30H2;2*1H4 |
| InChIKey | AMLFTIUTDJLMDH-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|