C36H50O6 — CID 162270542
methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-4,6,8,12,14,16,20,22,24,26-decaenyl]-1,3-dioxolan-2-one (PubChem CID 162270542) has the molecular formula C36H50O6 and a molecular weight of 578.79 g/mol. Its IUPAC name is methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-4,6,8,12,14,16,20,22,24,26-decaenyl]-1,3-dioxolan-2-one.
| Compound Name | methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-4,6,8,12,14,16,20,22,24,26-decaenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 162270542 |
| Molecular Formula | C36H50O6 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | methane;4-[28-(2-oxo-1,3-dioxolan-4-yl)octacosa-4,6,8,12,14,16,20,22,24,26-decaenyl]-1,3-dioxolan-2-one |
| SMILES | C.C.O=C1OCC(CC=CC=CC=CC=CCCC=CC=CC=CCCC=CC=CC=CCCCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C34H42O6.2CH4/c35-33-37-29-31(39-33)27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28-32-30-38-34(36)40-32;;/h1-6,11-23,25,31-32H,7-10,24,26-30H2;2*1H4 |
| InChIKey | QRDUCKYEEPGZBK-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|