C11H24O2 — CID 162270596
1,3-bis(prop-1-en-2-yloxy)propane;methane (PubChem CID 162270596) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,3-bis(prop-1-en-2-yloxy)propane;methane.
| Compound Name | 1,3-bis(prop-1-en-2-yloxy)propane;methane |
|---|---|
| PubChem CID | 162270596 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 1,3-bis(prop-1-en-2-yloxy)propane;methane |
| SMILES | C.C.C=C(C)OCCCOC(=C)C |
| InChI | InChI=1S/C9H16O2.2CH4/c1-8(2)10-6-5-7-11-9(3)4;;/h1,3,5-7H2,2,4H3;2*1H4 |
| InChIKey | OLLRAENNETYMFL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|