About 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane
4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane (PubChem CID 162271243) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane.
Molecular Properties
| Compound Name | 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane |
| PubChem CID | 162271243 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane |
| SMILES | C.CC(C)C.CC(C)c1cn[nH]c1C(C)C |
| InChI | InChI=1S/C9H16N2.C4H10.CH4/c1-6(2)8-5-10-11-9(8)7(3)4;1-4(2)3;/h5-7H,1-4H3,(H,10,11);4H,1-3H3;1H4 |
| InChIKey | JAJZCVGIHPBPSF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane?
The IUPAC name of 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane (CID 162271243) is 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane.
What is the SMILES notation for 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane?
The canonical SMILES for 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane is C.CC(C)C.CC(C)c1cn[nH]c1C(C)C.
What is the InChIKey of 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane?
The InChIKey is JAJZCVGIHPBPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.C4H10.CH4/c1-6(2)8-5-10-11-9(8)7(3)4;1-4(2)3;/h5-7H,1-4H3,(H,10,11);4H,1-3H3;1H4.
What are the key properties of 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane?
4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane has a molecular weight of 226.41 g/mol, XLogP of 4.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(propan-2-yl)-1H-pyrazole;methane;2-methylpropane is sourced from PubChem (CID 162271243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).