C24H42N2O4S — CID 162271551
N-[2-(cyclopropanecarbonyl)-6-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(3,3-dimethylpiperidin-1-yl)acetamide;methane (PubChem CID 162271551) has the molecular formula C24H42N2O4S and a molecular weight of 454.68 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonyl)-6-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(3,3-dimethylpiperidin-1-yl)acetamide;methane.
| Compound Name | N-[2-(cyclopropanecarbonyl)-6-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(3,3-dimethylpiperidin-1-yl)acetamide;methane |
|---|---|
| PubChem CID | 162271551 |
| Molecular Formula | C24H42N2O4S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | N-[2-(cyclopropanecarbonyl)-6-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(3,3-dimethylpiperidin-1-yl)acetamide;methane |
| SMILES | C.CC1(C)CCCN(CC(=O)NC2C(C(=O)C3CC3)CC3CCC(S(C)(=O)=O)CC32)C1 |
| InChI | InChI=1S/C23H38N2O4S.CH4/c1-23(2)9-4-10-25(14-23)13-20(26)24-21-18-12-17(30(3,28)29)8-7-16(18)11-19(21)22(27)15-5-6-15;/h15-19,21H,4-14H2,1-3H3,(H,24,26);1H4 |
| InChIKey | BWDRJNQNQQCFPY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |