C21H32O3Si — CID 162271568
7-(dimethylsilylmethoxy)-9a,11a-dimethyl-2,3,5a,8,9,9b,10,11-octahydro-1H-indeno[4,5-c]isochromen-5-one (PubChem CID 162271568) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is 7-(dimethylsilylmethoxy)-9a,11a-dimethyl-2,3,5a,8,9,9b,10,11-octahydro-1H-indeno[4,5-c]isochromen-5-one.
| Compound Name | 7-(dimethylsilylmethoxy)-9a,11a-dimethyl-2,3,5a,8,9,9b,10,11-octahydro-1H-indeno[4,5-c]isochromen-5-one |
|---|---|
| PubChem CID | 162271568 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 7-(dimethylsilylmethoxy)-9a,11a-dimethyl-2,3,5a,8,9,9b,10,11-octahydro-1H-indeno[4,5-c]isochromen-5-one |
| SMILES | C[SiH](C)COC1=CC2C(=O)OC3=C4CCCC4(C)CCC3C2(C)CC1 |
| InChI | InChI=1S/C21H32O3Si/c1-20-9-5-6-15(20)18-16(8-10-20)21(2)11-7-14(23-13-25(3)4)12-17(21)19(22)24-18/h12,16-17,25H,5-11,13H2,1-4H3 |
| InChIKey | OROUYWFWMAPKLO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|