C27H50 — CID 162271576
methane;1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene;1,2,3,4-tetramethyl-5-propan-2-ylcyclopentane (PubChem CID 162271576) has the molecular formula C27H50 and a molecular weight of 374.70 g/mol. Its IUPAC name is methane;1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene;1,2,3,4-tetramethyl-5-propan-2-ylcyclopentane.
| Compound Name | methane;1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene;1,2,3,4-tetramethyl-5-propan-2-ylcyclopentane |
|---|---|
| PubChem CID | 162271576 |
| Molecular Formula | C27H50 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 374.39 |
| IUPAC Name | methane;1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene;1,2,3,4-tetramethyl-5-propan-2-ylcyclopentane |
| SMILES | C.CC(C)C1C(C)C(C)C(C)C1C.Cc1c(C)c(C)c(C(C)C)c(C)c1C |
| InChI | InChI=1S/C14H22.C12H24.CH4/c1-8(2)14-12(6)10(4)9(3)11(5)13(14)7;1-7(2)12-10(5)8(3)9(4)11(12)6;/h8H,1-7H3;7-12H,1-6H3;1H4 |
| InChIKey | JFPBZIVIUKHSOM-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |