C30H53N3O4 — CID 162272040
methane;methyl 1-[[2-(4-cyclohexylpiperidin-1-yl)acetyl]amino]-6-(3-methylmorpholin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate (PubChem CID 162272040) has the molecular formula C30H53N3O4 and a molecular weight of 519.77 g/mol. Its IUPAC name is methane;methyl 1-[[2-(4-cyclohexylpiperidin-1-yl)acetyl]amino]-6-(3-methylmorpholin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate.
| Compound Name | methane;methyl 1-[[2-(4-cyclohexylpiperidin-1-yl)acetyl]amino]-6-(3-methylmorpholin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 162272040 |
| Molecular Formula | C30H53N3O4 |
| Molecular Weight | 519.77 g/mol |
| Exact Mass | 519.40 |
| IUPAC Name | methane;methyl 1-[[2-(4-cyclohexylpiperidin-1-yl)acetyl]amino]-6-(3-methylmorpholin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxylate |
| SMILES | C.COC(=O)C1CC2CCC(N3CCOCC3C)CC2C1NC(=O)CN1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C29H49N3O4.CH4/c1-20-19-36-15-14-32(20)24-9-8-23-16-26(29(34)35-2)28(25(23)17-24)30-27(33)18-31-12-10-22(11-13-31)21-6-4-3-5-7-21;/h20-26,28H,3-19H2,1-2H3,(H,30,33);1H4 |
| InChIKey | WWPQCWKZAQXHKR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |