C14H15N3S — CID 162273970
3,5-diphenyl-1,2,4,6-thiatriazinane (PubChem CID 162273970) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3,5-diphenyl-1,2,4,6-thiatriazinane.
| Compound Name | 3,5-diphenyl-1,2,4,6-thiatriazinane |
|---|---|
| PubChem CID | 162273970 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3,5-diphenyl-1,2,4,6-thiatriazinane |
| SMILES | c1ccc(C2NSNC(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C14H15N3S/c1-3-7-11(8-4-1)13-15-14(17-18-16-13)12-9-5-2-6-10-12/h1-10,13-17H |
| InChIKey | OUEDEIYUTWMGSG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|