C28H22N8S2 — CID 162273973
6-(2,4-diphenyl-3-sulfanylidene-1H-1,2,4,5-tetrazin-6-yl)-2,4-diphenyl-1H-1,2,4,5-tetrazine-3-thione (PubChem CID 162273973) has the molecular formula C28H22N8S2 and a molecular weight of 534.67 g/mol. Its IUPAC name is 6-(2,4-diphenyl-3-sulfanylidene-1H-1,2,4,5-tetrazin-6-yl)-2,4-diphenyl-1H-1,2,4,5-tetrazine-3-thione.
| Compound Name | 6-(2,4-diphenyl-3-sulfanylidene-1H-1,2,4,5-tetrazin-6-yl)-2,4-diphenyl-1H-1,2,4,5-tetrazine-3-thione |
|---|---|
| PubChem CID | 162273973 |
| Molecular Formula | C28H22N8S2 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 6-(2,4-diphenyl-3-sulfanylidene-1H-1,2,4,5-tetrazin-6-yl)-2,4-diphenyl-1H-1,2,4,5-tetrazine-3-thione |
| SMILES | S=C1N(c2ccccc2)N=C(C2=NN(c3ccccc3)C(=S)N(c3ccccc3)N2)NN1c1ccccc1 |
| InChI | InChI=1S/C28H22N8S2/c37-27-33(21-13-5-1-6-14-21)29-25(30-34(27)22-15-7-2-8-16-22)26-31-35(23-17-9-3-10-18-23)28(38)36(32-26)24-19-11-4-12-20-24/h1-20H,(H,29,30)(H,31,32) |
| InChIKey | CVFOZOHOQBBWGB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|