About 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide
2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide (PubChem CID 162275325) has the molecular formula C16H25N3O2
and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide.
Molecular Properties
| Compound Name | 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide |
| PubChem CID | 162275325 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(C)=O.c1ccc(C2CCCC2)nc1 |
| InChI | InChI=1S/C10H13N.C6H12N2O2/c1-2-6-9(5-1)10-7-3-4-8-11-10;1-3-4-7-6(10)8-5(2)9/h3-4,7-9H,1-2,5-6H2;3-4H2,1-2H3,(H2,7,8,9,10) |
| InChIKey | GUTJXPBOJYCWDO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide?
The IUPAC name of 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide (CID 162275325) is 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide.
What is the SMILES notation for 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide?
The canonical SMILES for 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide is CCCNC(=O)NC(C)=O.c1ccc(C2CCCC2)nc1.
What is the InChIKey of 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide?
The InChIKey is GUTJXPBOJYCWDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C6H12N2O2/c1-2-6-9(5-1)10-7-3-4-8-11-10;1-3-4-7-6(10)8-5(2)9/h3-4,7-9H,1-2,5-6H2;3-4H2,1-2H3,(H2,7,8,9,10).
What are the key properties of 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide?
2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide has a molecular weight of 291.40 g/mol, XLogP of 2.98, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylpyridine;N-(propylcarbamoyl)acetamide is sourced from PubChem (CID 162275325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).