C53H92O5 — CID 162276502
4-[4,5,6,7,8,9,12,13,14,15,16,17,20,21,22,23,24,25-octadecamethyl-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one (PubChem CID 162276502) has the molecular formula C53H92O5 and a molecular weight of 809.31 g/mol. Its IUPAC name is 4-[4,5,6,7,8,9,12,13,14,15,16,17,20,21,22,23,24,25-octadecamethyl-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[4,5,6,7,8,9,12,13,14,15,16,17,20,21,22,23,24,25-octadecamethyl-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 162276502 |
| Molecular Formula | C53H92O5 |
| Molecular Weight | 809.31 g/mol |
| Exact Mass | 808.69 |
| IUPAC Name | 4-[4,5,6,7,8,9,12,13,14,15,16,17,20,21,22,23,24,25-octadecamethyl-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one |
| SMILES | C=C1OCC(CC=CC(C)C(C)C(C)C(C)C(C)C(C)C=CC(C)C(C)C(C)C(C)C(C)C(C)C=CC(C)C(C)C(C)C(C)C(C)C(C)C=CCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C53H92O5/c1-32(22-20-24-51-30-55-50(19)57-51)38(7)44(13)46(15)40(9)34(3)26-28-36(5)42(11)48(17)49(18)43(12)37(6)29-27-35(4)41(10)47(16)45(14)39(8)33(2)23-21-25-52-31-56-53(54)58-52/h20-23,26-29,32-49,51-52H,19,24-25,30-31H2,1-18H3 |
| InChIKey | KFXHZUOHQORBJH-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.31 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|