C41H55NOSi2 — CID 162277203
(5,8-dimethyl-4bH-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[3-(trimethylsilylmethyl)-1H-inden-1-yl]silane (PubChem CID 162277203) has the molecular formula C41H55NOSi2 and a molecular weight of 634.07 g/mol. Its IUPAC name is (5,8-dimethyl-4bH-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[3-(trimethylsilylmethyl)-1H-inden-1-yl]silane.
| Compound Name | (5,8-dimethyl-4bH-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[3-(trimethylsilylmethyl)-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 162277203 |
| Molecular Formula | C41H55NOSi2 |
| Molecular Weight | 634.07 g/mol |
| Exact Mass | 633.38 |
| IUPAC Name | (5,8-dimethyl-4bH-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[3-(trimethylsilylmethyl)-1H-inden-1-yl]silane |
| SMILES | Cc1ccc2c(c1)C1=C([Si](C)(CCCCCCOC(C)(C)C)C3C=C(C[Si](C)(C)C)c4ccccc43)c3ccccc3C1N2C |
| InChI | InChI=1S/C41H55NOSi2/c1-29-22-23-36-35(26-29)38-39(42(36)5)33-20-14-15-21-34(33)40(38)45(9,25-17-11-10-16-24-43-41(2,3)4)37-27-30(28-44(6,7)8)31-18-12-13-19-32(31)37/h12-15,18-23,26-27,37,39H,10-11,16-17,24-25,28H2,1-9H3 |
| InChIKey | CDBCHMDMMJIMLC-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.07 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|