C31H50N4O5Si — CID 162277303
5-[(6S)-1-(2-amino-4-butoxy-5-methoxybenzoyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-trimethyl-4H-pyrimidin-2-one (PubChem CID 162277303) has the molecular formula C31H50N4O5Si and a molecular weight of 586.85 g/mol. Its IUPAC name is 5-[(6S)-1-(2-amino-4-butoxy-5-methoxybenzoyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-trimethyl-4H-pyrimidin-2-one.
| Compound Name | 5-[(6S)-1-(2-amino-4-butoxy-5-methoxybenzoyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-trimethyl-4H-pyrimidin-2-one |
|---|---|
| PubChem CID | 162277303 |
| Molecular Formula | C31H50N4O5Si |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 586.36 |
| IUPAC Name | 5-[(6S)-1-(2-amino-4-butoxy-5-methoxybenzoyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-trimethyl-4H-pyrimidin-2-one |
| SMILES | CCCCOc1cc(N)c(C(=O)N2CCC(C3=CN(C)C(=O)N(C)C3C)=C[C@H]2CO[Si](C)(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C31H50N4O5Si/c1-11-12-15-39-28-18-26(32)24(17-27(28)38-8)29(36)35-14-13-22(25-19-33(6)30(37)34(7)21(25)2)16-23(35)20-40-41(9,10)31(3,4)5/h16-19,21,23H,11-15,20,32H2,1-10H3/t21?,23-/m0/s1 |
| InChIKey | SPCGQQCDKWLBDL-YANBTOMASA-N |
| XLogP | 5.89 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|