About 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide
3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide (PubChem CID 162277970) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide |
| PubChem CID | 162277970 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(/c1cccc(/C(C)=N/[H])c1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H23N3/c1-10(2)18(11(3)4)15(17)14-8-6-7-13(9-14)12(5)16/h6-11,16-17H,1-5H3/b16-12+,17-15- |
| InChIKey | NFGLLTSSKJQTPR-LRXYHQOISA-N |
| XLogP | 3.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide?
The IUPAC name of 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide (CID 162277970) is 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide.
What is the SMILES notation for 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide?
The canonical SMILES for 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide is [H]/N=C(/c1cccc(/C(C)=N/[H])c1)N(C(C)C)C(C)C.
What is the InChIKey of 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide?
The InChIKey is NFGLLTSSKJQTPR-LRXYHQOISA-N. The full InChI is InChI=1S/C15H23N3/c1-10(2)18(11(3)4)15(17)14-8-6-7-13(9-14)12(5)16/h6-11,16-17H,1-5H3/b16-12+,17-15-.
What are the key properties of 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide?
3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide has a molecular weight of 245.37 g/mol, XLogP of 3.52, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethanimidoyl-N,N-di(propan-2-yl)benzenecarboximidamide is sourced from PubChem (CID 162277970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).