C22H38O2 — CID 162278564
1-(3,3-dimethylcyclohexen-1-yl)ethanone;1-(2-methoxypropan-2-yl)-3,3-dimethylcyclohexene (PubChem CID 162278564) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclohexen-1-yl)ethanone;1-(2-methoxypropan-2-yl)-3,3-dimethylcyclohexene.
| Compound Name | 1-(3,3-dimethylcyclohexen-1-yl)ethanone;1-(2-methoxypropan-2-yl)-3,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 162278564 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 1-(3,3-dimethylcyclohexen-1-yl)ethanone;1-(2-methoxypropan-2-yl)-3,3-dimethylcyclohexene |
| SMILES | CC(=O)C1=CC(C)(C)CCC1.COC(C)(C)C1=CC(C)(C)CCC1 |
| InChI | InChI=1S/C12H22O.C10H16O/c1-11(2)8-6-7-10(9-11)12(3,4)13-5;1-8(11)9-5-4-6-10(2,3)7-9/h9H,6-8H2,1-5H3;7H,4-6H2,1-3H3 |
| InChIKey | PWOPPYMNOAXUGL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|