C36H60 — CID 162278753
2,2-dimethylpropane;1,2,3,6,7,8-hexamethyl-9-[2-(2,3,4,5-tetramethylcyclopentyl)propan-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 162278753) has the molecular formula C36H60 and a molecular weight of 492.88 g/mol. Its IUPAC name is 2,2-dimethylpropane;1,2,3,6,7,8-hexamethyl-9-[2-(2,3,4,5-tetramethylcyclopentyl)propan-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2,2-dimethylpropane;1,2,3,6,7,8-hexamethyl-9-[2-(2,3,4,5-tetramethylcyclopentyl)propan-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 162278753 |
| Molecular Formula | C36H60 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.47 |
| IUPAC Name | 2,2-dimethylpropane;1,2,3,6,7,8-hexamethyl-9-[2-(2,3,4,5-tetramethylcyclopentyl)propan-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | CC(C)(C)C.CC1=CC2C3C=C(C)C(C)=C(C)C3C(C(C)(C)C3C(C)C(C)C(C)C3C)C2C(C)=C1C |
| InChI | InChI=1S/C31H48.C5H12/c1-15-13-25-26-14-16(2)18(4)22(8)28(26)30(27(25)21(7)17(15)3)31(11,12)29-23(9)19(5)20(6)24(29)10;1-5(2,3)4/h13-14,19-20,23-30H,1-12H3;1-4H3 |
| InChIKey | FHKRRBFXGHLSCM-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |