C32H52 — CID 162278755
9-[(2,5-dimethylcyclopentyl)methyl]-1,2,3,6,7,8-hexamethyl-4b,8a,9,9a-tetrahydro-4aH-fluorene;2,2-dimethylpropane (PubChem CID 162278755) has the molecular formula C32H52 and a molecular weight of 436.77 g/mol. Its IUPAC name is 9-[(2,5-dimethylcyclopentyl)methyl]-1,2,3,6,7,8-hexamethyl-4b,8a,9,9a-tetrahydro-4aH-fluorene;2,2-dimethylpropane.
| Compound Name | 9-[(2,5-dimethylcyclopentyl)methyl]-1,2,3,6,7,8-hexamethyl-4b,8a,9,9a-tetrahydro-4aH-fluorene;2,2-dimethylpropane |
|---|---|
| PubChem CID | 162278755 |
| Molecular Formula | C32H52 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.41 |
| IUPAC Name | 9-[(2,5-dimethylcyclopentyl)methyl]-1,2,3,6,7,8-hexamethyl-4b,8a,9,9a-tetrahydro-4aH-fluorene;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.CC1=CC2C3C=C(C)C(C)=C(C)C3C(CC3C(C)CCC3C)C2C(C)=C1C |
| InChI | InChI=1S/C27H40.C5H12/c1-14-9-10-15(2)22(14)13-25-26-20(7)18(5)16(3)11-23(26)24-12-17(4)19(6)21(8)27(24)25;1-5(2,3)4/h11-12,14-15,22-27H,9-10,13H2,1-8H3;1-4H3 |
| InChIKey | AWHFCJZLMUYNFX-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |