C26H42N2Si — CID 162279171
3-[(ditert-butylamino)-methyl-phenylsilyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine (PubChem CID 162279171) has the molecular formula C26H42N2Si and a molecular weight of 410.72 g/mol. Its IUPAC name is 3-[(ditert-butylamino)-methyl-phenylsilyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine.
| Compound Name | 3-[(ditert-butylamino)-methyl-phenylsilyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 162279171 |
| Molecular Formula | C26H42N2Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | 3-[(ditert-butylamino)-methyl-phenylsilyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine |
| SMILES | CN(C)C1CC([Si](C)(c2ccccc2)N(C(C)(C)C)C(C)(C)C)C2C=CC=CC21 |
| InChI | InChI=1S/C26H42N2Si/c1-25(2,3)28(26(4,5)6)29(9,20-15-11-10-12-16-20)24-19-23(27(7)8)21-17-13-14-18-22(21)24/h10-18,21-24H,19H2,1-9H3 |
| InChIKey | ZMBSZWLCERRPRU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|