About lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide
lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide (PubChem CID 162280134) has the molecular formula C14H25BLiNSi
and a molecular weight of 253.20 g/mol. Its IUPAC name is lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide.
Molecular Properties
| Compound Name | lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide |
| PubChem CID | 162280134 |
| Molecular Formula | C14H25BLiNSi |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide |
| SMILES | CC(C)(C)[Si](C)(C)N1C=CC=C2CC=CB21.[CH3-].[Li+] |
| InChI | InChI=1S/C13H22BNSi.CH3.Li/c1-13(2,3)16(4,5)15-11-7-9-12-8-6-10-14(12)15;;/h6-7,9-11H,8H2,1-5H3;1H3;/q;-1;+1 |
| InChIKey | WHQMGICCTAVUEJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide?
The IUPAC name of lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide (CID 162280134) is lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide.
What is the SMILES notation for lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide?
The canonical SMILES for lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide is CC(C)(C)[Si](C)(C)N1C=CC=C2CC=CB21.[CH3-].[Li+].
What is the InChIKey of lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide?
The InChIKey is WHQMGICCTAVUEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22BNSi.CH3.Li/c1-13(2,3)16(4,5)15-11-7-9-12-8-6-10-14(12)15;;/h6-7,9-11H,8H2,1-5H3;1H3;/q;-1;+1.
What are the key properties of lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide?
lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide has a molecular weight of 253.20 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;5H-borolo[1,2-b]azaborinin-1-yl-tert-butyl-dimethylsilane;carbanide is sourced from PubChem (CID 162280134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).