C20H27BN2O — CID 162280901
2-methyl-3-(2,2,4,4,5-pentamethylpyrrolidin-1-yl)-[1]benzofuro[2,3-d]azaborinine (PubChem CID 162280901) has the molecular formula C20H27BN2O and a molecular weight of 322.26 g/mol. Its IUPAC name is 2-methyl-3-(2,2,4,4,5-pentamethylpyrrolidin-1-yl)-[1]benzofuro[2,3-d]azaborinine.
| Compound Name | 2-methyl-3-(2,2,4,4,5-pentamethylpyrrolidin-1-yl)-[1]benzofuro[2,3-d]azaborinine |
|---|---|
| PubChem CID | 162280901 |
| Molecular Formula | C20H27BN2O |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 2-methyl-3-(2,2,4,4,5-pentamethylpyrrolidin-1-yl)-[1]benzofuro[2,3-d]azaborinine |
| SMILES | CC1N(B2C=c3oc4ccccc4c3=CN2C)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C20H27BN2O/c1-14-19(2,3)13-20(4,5)23(14)21-11-18-16(12-22(21)6)15-9-7-8-10-17(15)24-18/h7-12,14H,13H2,1-6H3 |
| InChIKey | VMIOUVSEBGXMBB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|