C30H41N9O3 — CID 162281572
(2R,3S,4R,5R)-2-[[[3-[2-[6-[1-(aminomethyl)cyclopropyl]-1H-benzimidazol-2-yl]ethyl]cyclobutyl]-propan-2-ylamino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol (PubChem CID 162281572) has the molecular formula C30H41N9O3 and a molecular weight of 575.72 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[[3-[2-[6-[1-(aminomethyl)cyclopropyl]-1H-benzimidazol-2-yl]ethyl]cyclobutyl]-propan-2-ylamino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[[3-[2-[6-[1-(aminomethyl)cyclopropyl]-1H-benzimidazol-2-yl]ethyl]cyclobutyl]-propan-2-ylamino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 162281572 |
| Molecular Formula | C30H41N9O3 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[[3-[2-[6-[1-(aminomethyl)cyclopropyl]-1H-benzimidazol-2-yl]ethyl]cyclobutyl]-propan-2-ylamino]methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| SMILES | CC(C)N(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(CCc2nc3ccc(C4(CN)CC4)cc3[nH]2)C1 |
| InChI | InChI=1S/C30H41N9O3/c1-16(2)38(12-22-25(40)26(41)29(42-22)39-15-35-24-27(32)33-14-34-28(24)39)19-9-17(10-19)3-6-23-36-20-5-4-18(11-21(20)37-23)30(13-31)7-8-30/h4-5,11,14-17,19,22,25-26,29,40-41H,3,6-10,12-13,31H2,1-2H3,(H,36,37)(H2,32,33,34)/t17?,19?,22-,25-,26-,29-/m1/s1 |
| InChIKey | FTPZIOVOHSLFAJ-XKHGBIBOSA-N |
| XLogP | 2.02 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |