C15H34N4+2 — CID 162281660
1,2,2,4,4,6,8,8,9,9-decamethyl-1,6-diaza-4,9-diazoniaspiro[4.4]nonane (PubChem CID 162281660) has the molecular formula C15H34N4+2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1,2,2,4,4,6,8,8,9,9-decamethyl-1,6-diaza-4,9-diazoniaspiro[4.4]nonane.
| Compound Name | 1,2,2,4,4,6,8,8,9,9-decamethyl-1,6-diaza-4,9-diazoniaspiro[4.4]nonane |
|---|---|
| PubChem CID | 162281660 |
| Molecular Formula | C15H34N4+2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.28 |
| IUPAC Name | 1,2,2,4,4,6,8,8,9,9-decamethyl-1,6-diaza-4,9-diazoniaspiro[4.4]nonane |
| SMILES | CN1CC(C)(C)[N+](C)(C)C12N(C)C(C)(C)C[N+]2(C)C |
| InChI | InChI=1S/C15H34N4/c1-13(2)12-18(7,8)15(17(13)6)16(5)11-14(3,4)19(15,9)10/h11-12H2,1-10H3/q+2 |
| InChIKey | HQMQXCPQIDPFNG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|