C23H31NO6 — CID 162281726
4-[4-[(2R)-1-(6-carboxyhexyl)-6-oxopiperidin-2-yl]-2-hydroxybut-3-enyl]benzoic acid (PubChem CID 162281726) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is 4-[4-[(2R)-1-(6-carboxyhexyl)-6-oxopiperidin-2-yl]-2-hydroxybut-3-enyl]benzoic acid.
| Compound Name | 4-[4-[(2R)-1-(6-carboxyhexyl)-6-oxopiperidin-2-yl]-2-hydroxybut-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 162281726 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-[4-[(2R)-1-(6-carboxyhexyl)-6-oxopiperidin-2-yl]-2-hydroxybut-3-enyl]benzoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC[C@@H]1C=CC(O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H31NO6/c25-20(16-17-9-11-18(12-10-17)23(29)30)14-13-19-6-5-7-21(26)24(19)15-4-2-1-3-8-22(27)28/h9-14,19-20,25H,1-8,15-16H2,(H,27,28)(H,29,30)/t19-,20?/m1/s1 |
| InChIKey | XWHFQTYWCIQTOD-FIWHBWSRSA-N |
| XLogP | 3.26 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|