About ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one
ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one (PubChem CID 162282715) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one.
Molecular Properties
| Compound Name | ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one |
| PubChem CID | 162282715 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one |
| SMILES | CC.CC(C)C1=C(C(C)C)CN(C(C)C)C(=O)C=C1 |
| InChI | InChI=1S/C15H25NO.C2H6/c1-10(2)13-7-8-15(17)16(12(5)6)9-14(13)11(3)4;1-2/h7-8,10-12H,9H2,1-6H3;1-2H3 |
| InChIKey | FKLOQBADMRHQRY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one?
The IUPAC name of ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one (CID 162282715) is ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one.
What is the SMILES notation for ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one?
The canonical SMILES for ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one is CC.CC(C)C1=C(C(C)C)CN(C(C)C)C(=O)C=C1.
What is the InChIKey of ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one?
The InChIKey is FKLOQBADMRHQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO.C2H6/c1-10(2)13-7-8-15(17)16(12(5)6)9-14(13)11(3)4;1-2/h7-8,10-12H,9H2,1-6H3;1-2H3.
What are the key properties of ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one?
ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one has a molecular weight of 265.44 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,3,4-tri(propan-2-yl)-2H-azepin-7-one is sourced from PubChem (CID 162282715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).