C21H21FN2 — CID 162282931
2-(4-fluorophenyl)-4-hexa-2,4-dien-3-yl-5-hexa-1,3,5-trien-3-yl-1H-imidazole (PubChem CID 162282931) has the molecular formula C21H21FN2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-hexa-2,4-dien-3-yl-5-hexa-1,3,5-trien-3-yl-1H-imidazole.
| Compound Name | 2-(4-fluorophenyl)-4-hexa-2,4-dien-3-yl-5-hexa-1,3,5-trien-3-yl-1H-imidazole |
|---|---|
| PubChem CID | 162282931 |
| Molecular Formula | C21H21FN2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-(4-fluorophenyl)-4-hexa-2,4-dien-3-yl-5-hexa-1,3,5-trien-3-yl-1H-imidazole |
| SMILES | C=CC=C(C=C)c1[nH]c(-c2ccc(F)cc2)nc1C(C=CC)=CC |
| InChI | InChI=1S/C21H21FN2/c1-5-9-15(7-3)19-20(16(8-4)10-6-2)24-21(23-19)17-11-13-18(22)14-12-17/h5-14H,1,3H2,2,4H3,(H,23,24) |
| InChIKey | MPKVHTWNGVTEDQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|