C12H10N2 — CID 162284750
8-methyl-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,8,10-hexaene (PubChem CID 162284750) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 8-methyl-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,8,10-hexaene.
| Compound Name | 8-methyl-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,8,10-hexaene |
|---|---|
| PubChem CID | 162284750 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 8-methyl-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,8,10-hexaene |
| SMILES | Cc1c2cc[nH]cc-2c2cnccc12 |
| InChI | InChI=1S/C12H10N2/c1-8-9-2-4-13-6-11(9)12-7-14-5-3-10(8)12/h2-7,13H,1H3 |
| InChIKey | ASGMEUJNIPBEAS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |