About methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate
methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate (PubChem CID 162287123) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate.
Molecular Properties
| Compound Name | methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate |
| PubChem CID | 162287123 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate |
| SMILES | COC(=O)CC=Cc1ccc2c(c1)C1(CCN(C)C1)CN2C |
| InChI | InChI=1S/C18H24N2O2/c1-19-10-9-18(12-19)13-20(2)16-8-7-14(11-15(16)18)5-4-6-17(21)22-3/h4-5,7-8,11H,6,9-10,12-13H2,1-3H3 |
| InChIKey | PJWRPJABJNQANT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate?
The IUPAC name of methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate (CID 162287123) is methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate.
What is the SMILES notation for methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate?
The canonical SMILES for methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate is COC(=O)CC=Cc1ccc2c(c1)C1(CCN(C)C1)CN2C.
What is the InChIKey of methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate?
The InChIKey is PJWRPJABJNQANT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-19-10-9-18(12-19)13-20(2)16-8-7-14(11-15(16)18)5-4-6-17(21)22-3/h4-5,7-8,11H,6,9-10,12-13H2,1-3H3.
What are the key properties of methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate?
methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate has a molecular weight of 300.40 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,1'-dimethylspiro[2H-indole-3,3'-pyrrolidine]-5-yl)but-3-enoate is sourced from PubChem (CID 162287123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).