C16H32N4+2 — CID 162287352
1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium (PubChem CID 162287352) has the molecular formula C16H32N4+2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium.
| Compound Name | 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium |
|---|---|
| PubChem CID | 162287352 |
| Molecular Formula | C16H32N4+2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium |
| SMILES | CN1C=CN(C)C1.C[N+](C)(C)C.Cc1cc[n+](C)cc1 |
| InChI | InChI=1S/C7H10N.C5H10N2.C4H12N/c1-7-3-5-8(2)6-4-7;1-6-3-4-7(2)5-6;1-5(2,3)4/h3-6H,1-2H3;3-4H,5H2,1-2H3;1-4H3/q+1;;+1 |
| InChIKey | ABWSPGIZCCDFHN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|