About 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium
1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium (PubChem CID 162287352) has the molecular formula C16H32N4+2
and a molecular weight of 280.46 g/mol. Its IUPAC name is 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium.
Molecular Properties
| Compound Name | 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium |
| PubChem CID | 162287352 |
| Molecular Formula | C16H32N4+2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium |
| SMILES | CN1C=CN(C)C1.C[N+](C)(C)C.Cc1cc[n+](C)cc1 |
| InChI | InChI=1S/C7H10N.C5H10N2.C4H12N/c1-7-3-5-8(2)6-4-7;1-6-3-4-7(2)5-6;1-5(2,3)4/h3-6H,1-2H3;3-4H,5H2,1-2H3;1-4H3/q+1;;+1 |
| InChIKey | ABWSPGIZCCDFHN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium?
The IUPAC name of 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium (CID 162287352) is 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium.
What is the SMILES notation for 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium?
The canonical SMILES for 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium is CN1C=CN(C)C1.C[N+](C)(C)C.Cc1cc[n+](C)cc1.
What is the InChIKey of 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium?
The InChIKey is ABWSPGIZCCDFHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N.C5H10N2.C4H12N/c1-7-3-5-8(2)6-4-7;1-6-3-4-7(2)5-6;1-5(2,3)4/h3-6H,1-2H3;3-4H,5H2,1-2H3;1-4H3/q+1;;+1.
What are the key properties of 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium?
1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium has a molecular weight of 280.46 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2H-imidazole;1,4-dimethylpyridin-1-ium;tetramethylazanium is sourced from PubChem (CID 162287352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).