C20H28N2O2P2 — CID 162287977
2-[2-(2,5-dimethylphospholan-1-yl)phenyl]-1,3-dimethyl-1,3,6,7-tetrahydro-[1,2,4]diazaphospholo[1,2-a]pyridazine-5,8-dione (PubChem CID 162287977) has the molecular formula C20H28N2O2P2 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphospholan-1-yl)phenyl]-1,3-dimethyl-1,3,6,7-tetrahydro-[1,2,4]diazaphospholo[1,2-a]pyridazine-5,8-dione.
| Compound Name | 2-[2-(2,5-dimethylphospholan-1-yl)phenyl]-1,3-dimethyl-1,3,6,7-tetrahydro-[1,2,4]diazaphospholo[1,2-a]pyridazine-5,8-dione |
|---|---|
| PubChem CID | 162287977 |
| Molecular Formula | C20H28N2O2P2 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[2-(2,5-dimethylphospholan-1-yl)phenyl]-1,3-dimethyl-1,3,6,7-tetrahydro-[1,2,4]diazaphospholo[1,2-a]pyridazine-5,8-dione |
| SMILES | CC1CCC(C)P1c1ccccc1P1C(C)N2C(=O)CCC(=O)N2C1C |
| InChI | InChI=1S/C20H28N2O2P2/c1-13-9-10-14(2)25(13)17-7-5-6-8-18(17)26-15(3)21-19(23)11-12-20(24)22(21)16(26)4/h5-8,13-16H,9-12H2,1-4H3 |
| InChIKey | XOWUGJNVYQAGPN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|