About 2-methylbutane;bis(2-methylbut-2-ene)
2-methylbutane;bis(2-methylbut-2-ene) (PubChem CID 162288148) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is 2-methylbutane;bis(2-methylbut-2-ene).
Molecular Properties
| Compound Name | 2-methylbutane;bis(2-methylbut-2-ene) |
| PubChem CID | 162288148 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 2-methylbutane;bis(2-methylbut-2-ene) |
| SMILES | CC=C(C)C.CC=C(C)C.CCC(C)C |
| InChI | InChI=1S/C5H12.2C5H10/c3*1-4-5(2)3/h5H,4H2,1-3H3;2*4H,1-3H3 |
| InChIKey | GXRHWCWOTMULRR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutane;bis(2-methylbut-2-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;bis(2-methylbut-2-ene)?
The IUPAC name of 2-methylbutane;bis(2-methylbut-2-ene) (CID 162288148) is 2-methylbutane;bis(2-methylbut-2-ene).
What is the SMILES notation for 2-methylbutane;bis(2-methylbut-2-ene)?
The canonical SMILES for 2-methylbutane;bis(2-methylbut-2-ene) is CC=C(C)C.CC=C(C)C.CCC(C)C.
What is the InChIKey of 2-methylbutane;bis(2-methylbut-2-ene)?
The InChIKey is GXRHWCWOTMULRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.2C5H10/c3*1-4-5(2)3/h5H,4H2,1-3H3;2*4H,1-3H3.
What are the key properties of 2-methylbutane;bis(2-methylbut-2-ene)?
2-methylbutane;bis(2-methylbut-2-ene) has a molecular weight of 212.42 g/mol, XLogP of 6.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;bis(2-methylbut-2-ene) is sourced from PubChem (CID 162288148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).