C38H54N4O4 — CID 162288792
N-[2-[3-[3-(2-cyclopentylethyl)-1-(2,6-dimethylcyclohexyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylbutanamide (PubChem CID 162288792) has the molecular formula C38H54N4O4 and a molecular weight of 630.87 g/mol. Its IUPAC name is N-[2-[3-[3-(2-cyclopentylethyl)-1-(2,6-dimethylcyclohexyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[2-[3-[3-(2-cyclopentylethyl)-1-(2,6-dimethylcyclohexyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 162288792 |
| Molecular Formula | C38H54N4O4 |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | N-[2-[3-[3-(2-cyclopentylethyl)-1-(2,6-dimethylcyclohexyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylbutanamide |
| SMILES | CCN(CC)c1ccc(C2=C(O)C(=C3C(=O)N(C4C(C)CCCC4C)N=C3CCC3CCCC3)C2=O)c(NC(=O)C(C)(C)CC)c1 |
| InChI | InChI=1S/C38H54N4O4/c1-8-38(6,7)37(46)39-29-22-26(41(9-2)10-3)19-20-27(29)30-34(43)32(35(30)44)31-28(21-18-25-16-11-12-17-25)40-42(36(31)45)33-23(4)14-13-15-24(33)5/h19-20,22-25,33,43H,8-18,21H2,1-7H3,(H,39,46) |
| InChIKey | MDJKDNXYZFBJRY-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|