C23H50N4+2 — CID 162289140
4,4,9,9-tetraethyl-2,2,8,8-tetramethyl-1,6-di(propan-2-yl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane (PubChem CID 162289140) has the molecular formula C23H50N4+2 and a molecular weight of 382.68 g/mol. Its IUPAC name is 4,4,9,9-tetraethyl-2,2,8,8-tetramethyl-1,6-di(propan-2-yl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane.
| Compound Name | 4,4,9,9-tetraethyl-2,2,8,8-tetramethyl-1,6-di(propan-2-yl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane |
|---|---|
| PubChem CID | 162289140 |
| Molecular Formula | C23H50N4+2 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.40 |
| IUPAC Name | 4,4,9,9-tetraethyl-2,2,8,8-tetramethyl-1,6-di(propan-2-yl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane |
| SMILES | CC[N+]1(CC)CC(C)(C)N(C(C)C)C12N(C(C)C)CC(C)(C)[N+]2(CC)CC |
| InChI | InChI=1S/C23H50N4/c1-13-26(14-2)18-21(9,10)25(20(7)8)23(26)24(19(5)6)17-22(11,12)27(23,15-3)16-4/h19-20H,13-18H2,1-12H3/q+2 |
| InChIKey | BKNSOASDQJGXBG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|