About (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium
(1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium (PubChem CID 162289175) has the molecular formula C12H27N2+
and a molecular weight of 199.36 g/mol. Its IUPAC name is (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium.
Molecular Properties
| Compound Name | (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium |
| PubChem CID | 162289175 |
| Molecular Formula | C12H27N2+ |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.22 |
| IUPAC Name | (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium |
| SMILES | CCC(C)N1CC(CC)[N@@+](C)(CC)C1 |
| InChI | InChI=1S/C12H27N2/c1-6-11(4)13-9-12(7-2)14(5,8-3)10-13/h11-12H,6-10H2,1-5H3/q+1/t11?,12?,14-/m0/s1 |
| InChIKey | VDGNTGOCFYGMHV-YIZWMMSDSA-N |
| XLogP | 2.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium?
The IUPAC name of (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium (CID 162289175) is (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium.
What is the SMILES notation for (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium?
The canonical SMILES for (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium is CCC(C)N1CC(CC)[N@@+](C)(CC)C1.
What is the InChIKey of (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium?
The InChIKey is VDGNTGOCFYGMHV-YIZWMMSDSA-N. The full InChI is InChI=1S/C12H27N2/c1-6-11(4)13-9-12(7-2)14(5,8-3)10-13/h11-12H,6-10H2,1-5H3/q+1/t11?,12?,14-/m0/s1.
What are the key properties of (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium?
(1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium has a molecular weight of 199.36 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-butan-2-yl-1,5-diethyl-1-methylimidazolidin-1-ium is sourced from PubChem (CID 162289175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).